2-Fluoride-6-Bromine Bromine Benzyl

2-Fluoride-6-Bromine Bromine Benzyl - Names and Identifiers

Name	2-Fluoro-6-bromobenzyl bromide
Synonyms	2-Fluoro-6-bromobenzyl bromide 2-Bromo-6-fluorobenzyl bromide 6-Fluoro-2-bromobenzyl Bromide 6-Bromo-2-fluorobenzyl bromide 2-Fluoride-6-Bromine Bromine Benzyl 1-Bromo-2-(bromomethyl)-3-fluorobenzene Benzene, 1-bromo-2-(bromomethyl)-3-fluoro- benzene, 1-bromo-2-(bromomethyl)-3-fluoro- 1-Bromo-2-(bromomethyl)-3-fluorobenzene, alpha,2-Dibromo-6-fluorotoluene
CAS	1548-81-8
InChI	InChI=1/C7H5Br2F/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2

2-Fluoride-6-Bromine Bromine Benzyl - Physico-chemical Properties

Molecular Formula	C7H5Br2F
Molar Mass	267.92
Density	1.923±0.06 g/cm3(Predicted)
Boling Point	128-131 °C(Press: 25 Torr)
Flash Point	104.4°C
Vapor Presure	0.037mmHg at 25°C
Storage Condition	2-8℃
Refractive Index	1.583

2-Fluoride-6-Bromine Bromine Benzyl - Introduction

2-Fluoro-6-bromobenzyl bromide, chemical formula C7H5Br2F, is an organic compound.

Nature:
1. Appearance: colorless or yellowish crystal.
2. Melting Point: 50-52 ° C.
3. Boiling Point: 219 ° C.
4. Density: 1.70g/cm³.
5. Solubility: Soluble in organic solvents such as ether and chloroform.

Use:
1. 2-Fluoro-6-bromobenzyl bromide can be used as pesticide intermediates for the synthesis of phenoxypyrazole and imidacloprid pesticides.
2. It can also be used to synthesize some important compounds in organic synthesis, such as heterocyclic compounds.

Method:
2-Fluoro-6-bromobenzyl bromide can be synthesized in the following steps:
1. The reaction of phenyl alcohol and phosphorus dibromide generates phenyl bromide.
2. Reaction of phenyl bromide with hydrofluoric acid to give 2-fluorophenyl bromide.
3. Finally, 2-fluorophenyl bromide is reacted with benzyl bromide to form 2-fluororo-6-bromobenzyl bromide.

Safety Information:
1. 2-Fluoro-6-bromobenzyl bromide is an organic compound that may be harmful to the human body. When handling, wear protective gloves, glasses and protective clothing.
2. It is a combustible material, the case of fire or high temperature may cause combustion.
3. During storage and use, contact with incompatible substances such as oxidants, strong acids and strong bases should be avoided.
4. It is recommended to use in a well-ventilated place, and away from fire and high temperature areas. In case of accidental inhalation or skin contact, rinse immediately with water and seek medical assistance.

Last Update：2024-04-10 22:29:15